CAS 25018-27-3
:trehalose octaacetate
Description:
Trehalose octaacetate is an organic compound derived from trehalose, a disaccharide composed of two glucose molecules. It is characterized by the presence of eight acetyl groups attached to the hydroxyl groups of trehalose, which significantly alters its physical and chemical properties. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as chloroform and acetone, but has limited solubility in water due to its hydrophobic acetyl groups. Trehalose octaacetate is often studied for its potential applications in drug delivery systems, as it can form nanoparticles and improve the solubility and stability of hydrophobic drugs. Additionally, it exhibits low toxicity and biocompatibility, making it a candidate for various biomedical applications. Its unique structure allows for the manipulation of its properties, which can be tailored for specific uses in pharmaceuticals and materials science. Overall, trehalose octaacetate is a versatile compound with promising applications in various fields.
Formula:C28H38O19
InChI:InChI=1/C28H38O19/c1-11(29)37-9-19-21(39-13(3)31)23(41-15(5)33)25(43-17(7)35)27(45-19)47-28-26(44-18(8)36)24(42-16(6)34)22(40-14(4)32)20(46-28)10-38-12(2)30/h19-28H,9-10H2,1-8H3/t19-,20-,21-,22-,23+,24+,25-,26-,27-,28-/m1/s1
Synonyms:- 2,3,4,6-tetra-O-acetylhexopyranosyl 2,3,4,6-tetra-O-acetylhexopyranoside
- 2,3,4,6-tetra-O-acetyl-alpha-D-glucopyranosyl 2,3,4,6-tetra-O-acetyl-alpha-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Trehalose octaacetate
CAS:Trehalose octaacetate is a carbohydrate that can be synthesized from trehalose and acetyl coenzyme A. It has been shown to act as an enzymatic substrate and a carbon source in the production of microparticles. Trehalose octaacetate is an antigenic molecule that can be used as a vaccine adjuvant to enhance the immune response to antigens. It also exhibits anti-inflammatory properties, which may be due to its ability to inhibit prostaglandin synthesis. Trehalose octaacetate is highly viscous, which makes it useful for the formulation of medications such as eye drops.Formula:C28H38O19Purity:Min. 95%Molecular weight:678.59 g/mol
