CAS 25020-13-7
:Fructose-histidine
Description:
Fructose-histidine, with the CAS number 25020-13-7, is a compound formed from the combination of fructose, a simple sugar, and histidine, an essential amino acid. This substance is characterized by its role in various biochemical processes, particularly in the context of metabolism and nutrition. Fructose is known for its sweetness and is a key energy source, while histidine plays a crucial role in protein synthesis and is involved in the production of histamine, which is important for immune responses. The interaction between these two components may influence their stability, solubility, and bioavailability. Fructose-histidine may exhibit unique properties such as enhanced sweetness compared to fructose alone and potential antioxidant activity due to the presence of histidine. Additionally, it may have implications in food science, nutrition, and health, particularly in the context of metabolic pathways and the regulation of blood sugar levels. However, specific applications and effects would depend on further research into its behavior in biological systems.
Formula:C12H19N3O7
InChI:InChI=1S/C12H19N3O7/c16-4-9(18)11(20)10(19)8(17)3-14-7(12(21)22)1-6-2-13-5-15-6/h2,5,7,9-11,14,16,18-20H,1,3-4H2,(H,13,15)(H,21,22)/t7-,9+,10+,11+/m0/s1
InChI key:InChIKey=GSVIFAPVCHKNHF-AYHFEMFVSA-N
SMILES:C([C@H](NCC([C@H]([C@@H]([C@@H](CO)O)O)O)=O)C(O)=O)C1=CN=CN1
Synonyms:- Fructose, 1-[(1-carboxy-2-imidazol-4-ylethyl)amino]-1-deoxy-, D-
- N-(1-Deoxy-D-fructos-1-yl)-L-histidine
- L-Histidine, N-(1-deoxy-D-fructos-1-yl)-
- D-Fructose, 1-[[1-carboxy-2-(1H-imidazol-4-yl)ethyl]amino]-1-deoxy-, (S)-
- Fructose-histidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Fructose-histidine
CAS:Controlled ProductApplications Fructose-histidine is an amadori compound formed in food.
References Wang, J., et al.: J. Mass Spec., 43, 262 (2008); Hashiba, H.: J. Agri. Food Chem., 24, 70 (1976)Formula:C12H19N3O7Color and Shape:NeatMolecular weight:317.3
