CAS 25021-49-2

4-(2-methyl-1,3-thiazol-4-yl)aniline

Description:

4-(2-Methyl-1,3-thiazol-4-yl)aniline, with the CAS number 25021-49-2, is an organic compound characterized by its aromatic amine structure. It features a thiazole ring, which is a five-membered heterocyclic compound containing sulfur and nitrogen, attached to an aniline moiety. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to the presence of the hydrophobic aromatic ring. The thiazole group can impart unique chemical reactivity, making it useful in various applications, including pharmaceuticals and agrochemicals. The compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of more complex molecules. Its properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and purity of the sample. Safety data should be consulted for handling and usage, as aromatic amines can pose health risks. Overall, 4-(2-methyl-1,3-thiazol-4-yl)aniline is a compound of interest in organic synthesis and medicinal chemistry.

Formula: C₁₀H₁₀N₂S

InChI: InChI=1/C10H10N2S/c1-7-12-10(6-13-7)8-2-4-9(11)5-3-8/h2-6H,11H2,1H3

SMILES: Cc1nc(cs1)c1ccc(cc1)N

Synonyms:

• 2-Methyl-4-(para-aminophenyl)thiazole
• 4-(2-Methyl-1,3-Thiazol-4-Yl)Phenylamine
• Benzenamine, 4-(2-methyl-4-thiazolyl)-

4-(2-Methyl-1,3-thiazol-4-yl)aniline

CAS: 25021-49-2

Formula: C₁₀H₁₀N₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 190.2648

Ref: IN-DA00BDKU

4-(2-Methyl-1,3-thiazol-4-yl)aniline

CAS: 25021-49-2

4-(2-Methyl-1,3-thiazol-4-yl)aniline

Formula: C₁₀H₁₀N₂S

Purity: 98%

Color and Shape: beige solid

Molecular weight: 190.26g/mol

Ref: 54-OR4380

4-(2-Methyl-1,3-thiazol-4-yl)aniline

CAS: 25021-49-2

Formula: C₁₀H₁₀N₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 190.26

Ref: 10-F042206