CAS 25026-64-6

3-Chloro-5-fluorobenzoic acid

Description:

3-Chloro-5-fluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of both chlorine and fluorine substituents on the benzene ring. Specifically, the chlorine atom is located at the meta position (3-position) and the fluorine atom at the para position (5-position) relative to the carboxylic acid group. This compound typically appears as a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. It exhibits acidic properties, allowing it to donate protons in solution. The presence of halogen atoms can influence its reactivity, making it useful in various chemical syntheses, particularly in the pharmaceutical and agrochemical industries. Additionally, the compound may exhibit biological activity, which can be explored for potential applications in drug development. Safety precautions should be taken when handling this substance, as halogenated compounds can pose health risks.

Formula: C₇H₃ClFO₂

InChI: InChI=1/C7H4ClFO2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H,10,11)/p-1

SMILES: c1c(cc(cc1Cl)F)C(=O)[O-]

Synonyms:

• Benzoic acid, 3-chloro-5-fluoro-
• 3-Chloro-5-Fluorobenzoate

3-Chloro-5-fluorobenzoic acid

CAS: 25026-64-6

Formula: C₇H₄ClFO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 174.5569

Ref: IN-DA007O9I

3-Chloro-5-fluorobenzoic acid

CAS: 25026-64-6

3-Chloro-5-fluorobenzoic acid

Formula: C₇H₄ClFO₂

Purity: ≥95%

Color and Shape: cream powder crystals

Molecular weight: 174.56g/mol

Ref: 54-PC3809

3-Chloro-5-fluorobenzoic acid

CAS: 25026-64-6

Formula: C₇H₄ClFO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 174.56

Ref: 10-F005181

3-Chloro-5-fluorobenzoic acid

CAS: 25026-64-6

Applications 3-Chloro-5-fluorobenzoic acid

Formula: C₇H₄ClFO₂

Color and Shape: Neat

Molecular weight: 174.56

Ref: TR-C584780