CymitQuimica logo

CAS 250275-20-8

:

Carbamic acid,[(3R,4R)-4-methyl-3-piperidinyl]-, 1,1-dimethylethyl ester, rel- (9CI)

Description:
Carbamic acid, [(3R,4R)-4-methyl-3-piperidinyl]-, 1,1-dimethylethyl ester, rel- (9CI) is a chemical compound characterized by its carbamate functional group, which is derived from carbamic acid. This compound features a piperidine ring, specifically a substituted piperidine with a methyl group at the 4-position and a 3-position substitution. The presence of the tert-butyl ester group contributes to its stability and solubility properties. Typically, carbamates like this one exhibit moderate to high lipophilicity, which can influence their biological activity and potential applications in pharmaceuticals or agrochemicals. The stereochemistry indicated by the (3R,4R) configuration suggests specific spatial arrangements of atoms that can affect the compound's reactivity and interaction with biological targets. Additionally, the compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. As with many carbamates, it is essential to handle this compound with care due to potential toxicity and environmental considerations.
Formula:C11H22N2O2
InChI:InChI=1S/C11H22N2O2/c1-8-5-6-12-7-9(8)13-10(14)15-11(2,3)4/h8-9,12H,5-7H2,1-4H3,(H,13,14)/t8-,9+/m1/s1
InChI key:SBAAVGHNGCRJNY-BDAKNGLRSA-N
SMILES:C[C@@H]1CCNC[C@@H]1NC(=O)OC(C)(C)C
Synonyms:
  • Carbamic acid, [(3R,4R)-4-methyl-3-piperidinyl]-, 1,1-dimethylethyl ester, rel-
Found 2 products.