CAS 250285-32-6
:1,3-Bis(2,6-diisopropylphenyl)imidazolium chloride
Description:
1,3-Bis(2,6-diisopropylphenyl)imidazolium chloride is an ionic liquid characterized by its imidazolium cation and chloride anion. This compound features a bulky, asymmetric structure due to the presence of two 2,6-diisopropylphenyl groups attached to the imidazolium ring, which contributes to its unique physical and chemical properties. It typically exhibits low volatility and high thermal stability, making it suitable for various applications in organic synthesis and catalysis. The presence of the bulky substituents enhances its solubility in organic solvents while also influencing its ionic conductivity. Additionally, this compound can act as a precursor for the synthesis of other functionalized ionic liquids or as a catalyst in various chemical reactions. Its properties can be further tailored by modifying the anion or the substituents on the imidazolium ring, allowing for a wide range of potential applications in fields such as materials science, electrochemistry, and green chemistry.
Formula:C27H37ClN2
InChI:InChI=1/C27H37N2.ClH/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;/h9-21H,1-8H3;1H/q+1;/p-1
Synonyms:- 1,3-bis[2,6-bis(1-methylethyl)phenyl]-1H-imidazol-3-ium
- 1,3-bis[2,6-bis(1-methylethyl)phenyl]-1H-imidazol-3-ium chloride
- 1,3-Bis(2,6-di-i-propylphenyl)imidazolium chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
1,3-Bis(2,6-diisopropylphenyl)imidazolium Chloride
CAS:Formula:C27H37ClN2Purity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:425.061,3-Bis(2,6-di-i-propylphenyl)imidazolium chloride, min. 97%
CAS:1,3-Bis(2,6-di-i-propylphenyl)imidazolium chloride, min. 97%
Formula:C27H37N2ClPurity:min. 97%Color and Shape:white to off-white pwdr.Molecular weight:425.061H-Imidazolium, 1,3-bis[2,6-bis(1-methylethyl)phenyl]-, chloride (1:1)
CAS:Formula:C27H37ClN2Purity:97%Color and Shape:SolidMolecular weight:425.04911,3-Bis[2,6-bis(isopropyl)phenyl]-1H-imidazol-3-ium chloride
CAS:1,3-Bis[2,6-bis(isopropyl)phenyl]-1H-imidazol-3-ium chlorideFormula:C27H37N2·ClPurity:97%Color and Shape: off-white to pink solidMolecular weight:425.05g/mol1,3-Bis(2,6-diisopropylphenyl)imidazolium Chloride (HPMC encapsulated)
CAS:Formula:C27H37ClN2Color and Shape:White to Almost white capsuleMolecular weight:425.061,3-Bis(2,6-diisopropylphenyl)imidazolium chloride
CAS:Formula:C27H37ClN2Purity:97%Color and Shape:SolidMolecular weight:425.061,3-Bis(2,6-diisopropylphenyl)imidazolium Chloride
CAS:Controlled ProductApplications 1,3-Bis(2,6-diisopropylphenyl)imidazolium Chloride is an imidazolium salt that is active against all stages of Trypanosoma cruzi and may represent a promising candidate for treatment of Chagas disease.
References Faral-Tello, P., et al.: Int J Antimicrob Agents, 43, 262-268 (2014)Formula:C19H27FOColor and Shape:NeatMolecular weight:290.4161,3-Bis(2,6-diisopropylphenyl)imidazolium chloride
CAS:1,3-Bis(2,6-diisopropylphenyl)imidazolium chloride is an organic compound that is used as a solvent. It was originally synthesized by reacting triethyl orthoformate with 2,6-diisopropylaniline. This reaction formed the corresponding imidazolium salt. The synthesis of this compound was later improved by using ring-opening polymerization of glycolide and furfural. 1,3-Bis(2,6-diisopropylphenyl)imidazolium chloride is mainly used to extract estradiol from urine samples in clinical laboratories.Formula:C27H37ClN2Purity:Min. 95%Color and Shape:White PowderMolecular weight:425.05 g/mol







