
CAS 25037-57-4
:Octamethylcyclotetrasiloxane homopolymer
Description:
Octamethylcyclotetrasiloxane homopolymer, identified by its CAS number 25037-57-4, is a silicone-based polymer characterized by its unique cyclic siloxane structure. This compound consists of repeating siloxane (Si-O) units, which contribute to its flexibility, thermal stability, and resistance to moisture. The polymer exhibits low surface tension and excellent lubricating properties, making it useful in various applications, including personal care products, cosmetics, and industrial lubricants. Additionally, it is known for its low volatility and high chemical stability, which enhances its performance in diverse environments. The material is generally non-toxic and biocompatible, which further broadens its applicability in consumer products. Its unique properties allow it to function effectively as a conditioning agent, providing a smooth feel and enhancing the texture of formulations. However, environmental considerations regarding the persistence of siloxanes in ecosystems have led to increased scrutiny and regulation of such compounds. Overall, octamethylcyclotetrasiloxane homopolymer is valued for its versatility and performance in both industrial and consumer applications.
Formula:(C8H24O4Si4)x
InChI:InChI=1S/C8H24O4Si4/c1-13(2)9-14(3,4)11-16(7,8)12-15(5,6)10-13/h1-8H3
InChI key:InChIKey=HMMGMWAXVFQUOA-UHFFFAOYSA-N
SMILES:C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1
Synonyms:- Cyclotetrasiloxane, 2,2,4,4,6,6,8,8-octamethyl-, homopolymer
- Poly(octamethylcyclotetrasiloxane)
- Cyclotetrasiloxane, octamethyl-, polymers
- Octamethylcyclotetrasiloxane polymer
- Cyclotetrasiloxane, octamethyl-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
