CymitQuimica logo

CAS 250371-81-4

:

1-(2-Fluoro-4-nitrophenyl)-4-methylpiperidine

Description:
1-(2-Fluoro-4-nitrophenyl)-4-methylpiperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring substituted with a 2-fluoro-4-nitrophenyl group and a methyl group at the 4-position. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential polarity due to the presence of the nitro and fluoro substituents. The fluorine atom can influence the compound's reactivity and lipophilicity, while the nitro group may contribute to its electronic properties, making it a candidate for various chemical reactions. The presence of the piperidine ring suggests potential biological activity, as piperidine derivatives are often explored in medicinal chemistry for their pharmacological properties. Additionally, the compound's molecular weight, solubility, and stability can vary based on environmental conditions and the presence of other functional groups. Overall, 1-(2-Fluoro-4-nitrophenyl)-4-methylpiperidine is of interest in both synthetic and medicinal chemistry contexts.
Formula:C12H15FN2O2
InChI:InChI=1S/C12H15FN2O2/c1-9-4-6-14(7-5-9)12-3-2-10(15(16)17)8-11(12)13/h2-3,8-9H,4-7H2,1H3
InChI key:InChIKey=WJTWAXSFXNZKEL-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(N(=O)=O)=C1)N2CCC(C)CC2
Synonyms:
  • 1-(2-Fluoro-4-nitrophenyl)-4-methylpiperidine
  • 3-Fluoro-4-(4-methyl-1-piperidinyl)nitrobenzene
  • Piperidine, 1-(2-fluoro-4-nitrophenyl)-4-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.