CAS 25045-36-7

2-methoxy-5-methylbenzoate

Description:

2-Methoxy-5-methylbenzoate, with the CAS number 25045-36-7, is an organic compound belonging to the class of benzoate esters. It features a methoxy group (-OCH3) and a methyl group (-CH3) attached to a benzoate structure, which contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid with a pleasant aromatic odor. It is moderately soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the methoxy and methyl substituents influences its reactivity and stability, making it useful in various applications, including as a flavoring agent, fragrance component, or in organic synthesis. Additionally, like many aromatic compounds, it may exhibit certain biological activities, although specific toxicity and safety data should be consulted for handling and usage. Overall, 2-methoxy-5-methylbenzoate is characterized by its aromatic nature, moderate solubility, and potential utility in chemical applications.

Formula: C₉H₉O₃

InChI: InChI=1/C9H10O3/c1-6-3-4-8(12-2)7(5-6)9(10)11/h3-5H,1-2H3,(H,10,11)/p-1

SMILES: Cc1ccc(c(c1)C(=O)O)OC

Synonyms:

• Benzoic Acid, 2-Methoxy-5-Methyl-
• 2-METHOXY-5-METHYLBENZOIC ACID

Benzoic acid, 2-methoxy-5-methyl-

CAS: 25045-36-7

Formula: C₉H₁₀O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 166.1739

Ref: IN-DA002Q98

2-Methoxy-5-methylbenzoic acid

CAS: 25045-36-7

2-Methoxy-5-methylbenzoic acid

Purity: 98%

Molecular weight: 166.17g/mol

Ref: 54-OR917839

2-Methoxy-5-methylbenzoic acid

CAS: 25045-36-7

Formula: C₉H₁₀O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 166.176

Ref: 10-F237143