CAS 25045-82-3

6-nitroH-imidazo[1,2-a]pyridine

Description:

6-NitroH-imidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of a nitro group at the 6-position enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. This compound typically exhibits moderate solubility in polar solvents due to the presence of nitrogen atoms in its structure, which can engage in hydrogen bonding. Its molecular structure allows for potential interactions with various biological targets, making it a candidate for research in pharmacology. Additionally, the compound may display fluorescence properties, which can be useful in analytical applications. Safety data should be consulted, as nitro compounds can sometimes be hazardous. Overall, 6-nitroH-imidazo[1,2-a]pyridine is a versatile compound with potential applications in drug development and chemical research.

Formula: C₇H₅N₃O₂

InChI: InChI=1/C7H5N3O2/c11-10(12)6-1-2-7-8-3-4-9(7)5-6/h1-5H

SMILES: c1cc2nccn2cc1N(=O)=O

Synonyms:

• 6-Nitroimidazo[1,2-a]pyridine
• 6-Nitro-imidazo(1,2-a)pyridine
• Imidazo[1,2-A]Pyridine, 6-Nitro-

Imidazo[1,2-a]pyridine, 6-nitro-

CAS: 25045-82-3

Formula: C₇H₅N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.1335

Ref: IN-DA002Q96

6-Nitroimidazo[1,2-a]pyridine

CAS: 25045-82-3

6-Nitroimidazo[1,2-a]pyridine

Purity: 97%

Molecular weight: 163.13g/mol

Ref: 54-OR305165

6-Nitroimidazo[1,2-a]pyridine

CAS: 25045-82-3

Formula: C₇H₅N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 163.136

Ref: 10-F069101