
CAS 25047-48-7
:Cleistanthin
Description:
Cleistanthin, with the CAS number 25047-48-7, is a chemical compound derived from the plant Cleistanthus collinus, which is known for its traditional medicinal uses. This substance is categorized as a phenolic compound, exhibiting various biological activities, including potential anti-inflammatory and analgesic properties. Cleistanthin is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its reactivity and interaction with biological systems. The compound is typically studied for its pharmacological effects and potential therapeutic applications, particularly in the context of natural product chemistry. Its solubility, stability, and reactivity can vary depending on environmental conditions and the presence of other substances. As with many natural compounds, further research is necessary to fully understand its mechanisms of action, safety profile, and potential uses in medicine or industry. Overall, Cleistanthin represents an interesting area of study within the field of phytochemistry and pharmacognosy.
Formula:C28H28O11
InChI:InChI=1S/C28H28O11/c1-31-18-8-14-15(9-19(18)32-2)25(39-28-24(29)26(34-4)21(33-3)11-36-28)16-10-35-27(30)23(16)22(14)13-5-6-17-20(7-13)38-12-37-17/h5-9,21,24,26,28-29H,10-12H2,1-4H3
InChI key:InChIKey=FCOQWUOWHWHTJP-UHFFFAOYSA-N
SMILES:O=C1C2=C(C=3C(C(OC4C(O)C(OC)C(OC)CO4)=C2CO1)=CC(OC)=C(OC)C3)C=5C=C6C(=CC5)OCO6
Synonyms:- 9-(1,3-Benzodioxol-5-yl)-4-[(3,4-di-O-methyl-D-xylopyranosyl)oxy]-6,7-dimethoxynaphtho[2,3-c]furan-1(3H)-one
- Naphtho[2,3-c]furan-1(3H)-one, 9-(1,3-benzodioxol-5-yl)-4-[(3,4-di-O-methyl-D-xylopyranosyl)oxy]-6,7-dimethoxy-
- Cleistanthin A
- Cleistanthin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cleistanthin
CAS:Cleistanthin, a toxic Cleistanthus collinus compound, has antihypertensive, alpha-antagonist, and diuretic properties; a modified naphthofuran-xylose.Formula:C28H28O11Color and Shape:SolidMolecular weight:540.52
