CymitQuimica logo

CAS 250600-43-2

:

1-[2-(4-bromophenoxy)ethyl]-1H-imidazole

Description:
1-[2-(4-bromophenoxy)ethyl]-1H-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a 4-bromophenoxy group attached to a 2-ethyl position of the imidazole, contributing to its unique properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the bromine atom in the phenoxy group can influence its reactivity and biological activity, potentially enhancing its lipophilicity. This compound may be of interest in medicinal chemistry, particularly for its potential pharmacological applications, as imidazole derivatives are known for various biological activities, including antifungal and antimicrobial properties. Additionally, the bromophenoxy moiety may impart specific interactions with biological targets, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C11H11BrN2O
InChI:InChI=1/C11H11BrN2O/c12-10-1-3-11(4-2-10)15-8-7-14-6-5-13-9-14/h1-6,9H,7-8H2
SMILES:c1cc(ccc1Br)OCCn1ccnc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.