CymitQuimica logo

CAS 250674-55-6

:

Ethyl 2,7-naphthyridine-3-carboxylate

Description:
Ethyl 2,7-naphthyridine-3-carboxylate is an organic compound characterized by its naphthyridine core, which is a bicyclic structure containing nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of the carboxylate group indicates that it can participate in various chemical reactions, such as esterification and nucleophilic substitutions. Ethyl 2,7-naphthyridine-3-carboxylate is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with naphthyridine derivatives. Additionally, the compound may be utilized in synthetic organic chemistry as an intermediate or building block for more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H10N2O2
InChI:InChI=1S/C11H10N2O2/c1-2-15-11(14)10-5-8-3-4-12-6-9(8)7-13-10/h3-7H,2H2,1H3
InChI key:InChIKey=MVKSZGJYPIHECU-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC2=C(C=N1)C=NC=C2
Synonyms:
  • 2,7-Naphthyridine-3-carboxylic acid, ethyl ester
  • Ethyl 2,7-naphthyridine-3-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.