CAS 2507-91-7
:Gloxazone
Description:
Gloxazone, with the CAS number 2507-91-7, is a chemical compound that belongs to the class of oxazolidinones. It is primarily recognized for its application in the field of agriculture, particularly as a herbicide. Gloxazone exhibits selective herbicidal properties, effectively controlling certain broadleaf weeds while being less harmful to crops. The compound functions by inhibiting specific biochemical pathways in target plants, disrupting their growth and development. In terms of physical characteristics, Gloxazone is typically a solid at room temperature, with moderate solubility in organic solvents and limited solubility in water. Its stability under various environmental conditions makes it suitable for agricultural use. However, like many chemical substances, it requires careful handling and application to minimize potential environmental impact and ensure safety for non-target organisms. As with any herbicide, adherence to regulatory guidelines and safety protocols is essential when using Gloxazone in agricultural practices.
Formula:C8H16N6OS2
InChI:InChI=1S/C8H16N6OS2/c1-3-15-5(2)6(12-14-8(10)17)4-11-13-7(9)16/h4-5H,3H2,1-2H3,(H3,9,13,16)(H3,10,14,17)
InChI key:InChIKey=ARIFZLJIERKKEL-UHFFFAOYSA-N
SMILES:C(C(OCC)C)(=NNC(N)=S)C=NNC(N)=S
Synonyms:- 2,2′-[1-(1-Ethoxyethyl)-1,2-ethanediylidene]bis[hydrazinecarbothioamide]
- Hydrazinecarbothioamide, 2,2′-[1-(1-ethoxyethyl)-1,2-ethanediylidene]bis-
- Contrapar
- (1-Ethoxyethyl)glyoxal bis(thiosemicarbazone)
- Butyraldehyde, 3-ethoxy-2-oxo-, bis(thiosemicarbazone)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
