CAS 250714-64-8

N-[(4-Fluorophenyl)sulfonyl]alanine

Description:

N-[(4-Fluorophenyl)sulfonyl]alanine is an organic compound characterized by the presence of an alanine amino acid backbone modified with a sulfonyl group attached to a para-fluorophenyl moiety. This compound features a sulfonamide functional group, which is known for its ability to form hydrogen bonds and participate in various chemical reactions. The fluorine atom on the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in certain solvents. N-[(4-Fluorophenyl)sulfonyl]alanine may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific enzymes or receptors. Its structural characteristics suggest potential applications in medicinal chemistry, where modifications to amino acids can lead to novel therapeutic agents. Additionally, the compound's stability and solubility are important factors for its practical use in laboratory and industrial settings. Overall, N-[(4-Fluorophenyl)sulfonyl]alanine represents a versatile building block in organic synthesis and drug development.

Formula: C₉H₁₀FNO₄S

InChI: InChI=1S/C9H10FNO4S/c1-6(9(12)13)11-16(14,15)8-4-2-7(10)3-5-8/h2-6,11H,1H3,(H,12,13)

InChI key: InChIKey=JOYNOYIEQOCUEJ-UHFFFAOYSA-N

SMILES: S(NC(C(O)=O)C)(=O)(=O)C1=CC=C(F)C=C1

Synonyms:

• Alanine, N-[(4-fluorophenyl)sulfonyl]-
• N-[(4-Fluorophenyl)sulfonyl]alanine
• 2-(4-Fluorobenzenesulfonamido)propanoic acid
• 2-[(4-Fluorophenyl)sulfonylamino]propanoic acid

2-(4-Fluorobenzenesulfonamido)propanoic acid

CAS: 250714-64-8

Versatile small molecule scaffold

Formula: C₉H₁₀FNO₄S

Purity: Min. 95%

Molecular weight: 247.25 g/mol

Ref: 3D-AKA71464