CAS 250714-81-9

N-[(4-Bromophenyl)sulfonyl]valine

Description:

N-[(4-Bromophenyl)sulfonyl]valine is an organic compound characterized by its sulfonamide functional group, which is linked to a valine amino acid structure. The presence of the 4-bromophenyl group introduces significant hydrophobic characteristics, influencing the compound's solubility and reactivity. This compound typically exhibits a crystalline solid form and is soluble in polar solvents due to the sulfonyl group, while its hydrophobic aromatic ring may limit solubility in non-polar solvents. The sulfonamide moiety can participate in hydrogen bonding, which may affect its biological activity and interactions with other molecules. N-[(4-Bromophenyl)sulfonyl]valine is of interest in medicinal chemistry, particularly for its potential applications in drug development, as sulfonamides are known for their antibacterial properties. Additionally, the bromine substituent can serve as a handle for further chemical modifications, enhancing its utility in synthetic chemistry. Overall, this compound's unique structural features contribute to its potential applications in various fields, including pharmaceuticals and biochemistry.

Formula: C₁₁H₁₄BrNO₄S

InChI: InChI=1S/C11H14BrNO4S/c1-7(2)10(11(14)15)13-18(16,17)9-5-3-8(12)4-6-9/h3-7,10,13H,1-2H3,(H,14,15)

InChI key: InChIKey=OWOVDTSLIWUYRA-UHFFFAOYSA-N

SMILES: S(NC(C(C)C)C(O)=O)(=O)(=O)C1=CC=C(Br)C=C1

Synonyms:

• Valine, N-[(4-bromophenyl)sulfonyl]-
• N-[(4-Bromophenyl)sulfonyl]valine

2-{[(4-Bromophenyl)sulfonyl]amino}-3-methylbutanoic acid

CAS: 250714-81-9

Versatile small molecule scaffold

Formula: C₁₁H₁₄BrNO₄S

Purity: Min. 95%

Molecular weight: 336.2 g/mol

Ref: 3D-AKA71481