CAS 250736-42-6

Benzo[b]thiophen-3(2H)-one, 5-bromo-, 1,1-dioxide

Description:

Benzo[b]thiophen-3(2H)-one, 5-bromo-, 1,1-dioxide, with the CAS number 250736-42-6, is a heterocyclic organic compound characterized by its unique structure that includes a benzothiophene core. This compound features a bromine substituent at the 5-position and a sulfone group (1,1-dioxide) that contributes to its chemical reactivity and properties. Typically, compounds of this nature exhibit significant biological activity, making them of interest in medicinal chemistry and drug development. The presence of the bromine atom can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the sulfone group can participate in various chemical reactions, including nucleophilic substitutions and oxidation processes. The compound's solubility, stability, and reactivity can vary based on its molecular structure and substituents, which are crucial for its application in research and potential therapeutic uses. Overall, Benzo[b]thiophen-3(2H)-one, 5-bromo-, 1,1-dioxide represents a valuable scaffold in the synthesis of novel compounds with potential pharmacological properties.

Formula: C₈H₅BrO₃S

InChI: InChI=1S/C8H5BrO3S/c9-5-1-2-8-6(3-5)7(10)4-13(8,11)12/h1-3H,4H2

InChI key: InChIKey=OSCAROHQYYOTHG-UHFFFAOYSA-N

SMILES: O=C1C=2C(S(=O)(=O)C1)=CC=C(Br)C2

Synonyms:

• Benzo[b]thiophen-3(2H)-one, 5-bromo-, 1,1-dioxide

5-Bromobenzo[b]thiophen-3(2H)-one 1,1-dioxide

CAS: 250736-42-6

Purity: >97%

Molecular weight: 261.0899963

Ref: 10-F737930

5-bromo-2,3-dihydro-1-benzothiophene-1,1,3-trione

CAS: 250736-42-6

Versatile small molecule scaffold

Formula: C₈H₅BrO₃S

Purity: Min. 95%

Molecular weight: 261.09 g/mol

Ref: 3D-AKA73642