CAS 250736-84-6
:(1S)-3-(acetyloxy)-1-carboxypropan-1-aminium chloride
Description:
(1S)-3-(Acetyloxy)-1-carboxypropan-1-aminium chloride is a chemical compound characterized by its functional groups and structural features. It contains an aminium group, indicating a positively charged nitrogen atom, which is typically involved in ionic interactions. The presence of a carboxylic acid group contributes to its acidity and potential for forming salts, while the acetyloxy group suggests the presence of an ester linkage, which can influence its reactivity and solubility. This compound is likely to be soluble in polar solvents due to its ionic nature and the presence of polar functional groups. Its stereochemistry, indicated by the (1S) designation, suggests specific spatial arrangements that can affect its biological activity and interactions with other molecules. The chloride ion serves as a counterion, stabilizing the overall structure. Such compounds may have applications in pharmaceuticals or biochemistry, particularly in contexts where specific stereochemistry and functional groups are crucial for activity.
Formula:C6H12ClNO4
InChI:InChI=1/C6H11NO4.ClH/c1-4(8)11-3-2-5(7)6(9)10;/h5H,2-3,7H2,1H3,(H,9,10);1H/t5-;/m0./s1
SMILES:CC(=O)OCC[C@@H](C(=O)O)N.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
O-Acetyl-L-homoserine Hydrochloride
CAS:Formula:C6H12ClNO4Purity:95%Color and Shape:SolidMolecular weight:197.6168O-Acetyl-L-homoserine Hydrochloride, 95%
CAS:Controlled ProductFormula:C6H11NO4·ClHPurity:95%Color and Shape:NeatMolecular weight:197.62O-Acetyl-L-homoserine hydrochloride
CAS:O-Acetyl-L-homoserine hydrochloride (OAH) is a ligand for IL-10, which enhances the expression of this cytokine. It has been shown to be an effective inhibitor of Streptococcus pyogenes and Lactobacillus plantarum. The binding specificity of OAH to lectins has also been demonstrated. This compound may have potential as a diagnostic tool for the measurement of sialic acid in Streptococcus and other organisms. Flow cytometric analysis has also been used to detect carbohydrate profiles in Saccharomyces cerevisiae strains.
Formula:C6H11NO4•HClPurity:Min. 95 Area-%Color and Shape:PowderMolecular weight:197.62 g/molRef: 3D-FA17124
Discontinued product



