CAS 250780-40-6: (3R,4R,5R,6R)-3,4,5-trihydroxy-6-[2-[4-[[4-methyl-6-(1-methylbenzimidazol-2-yl)-2-propyl-benzimidazol-1-yl]methyl]phenyl]benzoyl]oxy-tetrahydropyran-2-carboxylic acid
Description:The chemical substance with the name "(3R,4R,5R,6R)-3,4,5-trihydroxy-6-[2-[4-[[4-methyl-6-(1-methylbenzimidazol-2-yl)-2-propyl-benzimidazol-1-yl]methyl]phenyl]benzoyl]oxy-tetrahydropyran-2-carboxylic acid" and CAS number "250780-40-6" is a complex organic compound characterized by multiple functional groups, including hydroxyl (-OH) groups and a carboxylic acid (-COOH) moiety. Its structure features a tetrahydropyran ring, which contributes to its cyclic nature and potential stereochemistry, indicated by the specified R configurations. The presence of benzimidazole derivatives suggests potential biological activity, possibly related to pharmacological applications. The compound's intricate structure may influence its solubility, stability, and reactivity, making it of interest in medicinal chemistry and drug development. Additionally, the presence of multiple aromatic rings may enhance its interaction with biological targets, potentially leading to specific therapeutic effects. Overall, this compound exemplifies the complexity often found in bioactive molecules, which can be crucial for their function and efficacy in biological systems.
Formula:C39H38N4O8
InChI:InChI=1/C39H38N4O8/c1-4-9-30-41-31-21(2)18-24(36-40-27-12-7-8-13-28(27)42(36)3)19-29(31)43(30)20-22-14-16-23(17-15-22)25-10-5-6-11-26(25)38(49)51-39-34(46)32(44)33(45)35(50-39)37(47)48/h5-8,10-19,32-35,39,44-46H,4,9,20H2,1-3H3,(H,47,48)/t32-,33-,34-,35?,39-/m1/s1