CAS 25081-31-6: Nitrosoiminodiacetic acid
Description:Nitrosoiminodiacetic acid, with the CAS number 25081-31-6, is an organic compound characterized by the presence of both nitroso and imino functional groups. It typically appears as a white to light yellow crystalline solid. This compound is known for its chelating properties, allowing it to form stable complexes with metal ions, which can be useful in various applications, including analytical chemistry and biochemistry. The presence of the nitroso group imparts unique reactivity, making it a potential candidate for use in organic synthesis and as a reagent in various chemical reactions. Additionally, its imino group contributes to its ability to participate in hydrogen bonding, influencing its solubility and interaction with other molecules. Due to its specific functional groups, nitrosoiminodiacetic acid may exhibit biological activity, although detailed studies on its toxicity and environmental impact are necessary for a comprehensive understanding of its safety profile. Overall, this compound's unique structural features make it of interest in both research and industrial applications.
Formula:C4H6N2O5
InChI:InChI=1S/C4H6N2O5/c7-3(8)1-6(5-11)2-4(9)10/h1-2H2,(H,7,8)(H,9,10)
InChI key:InChIKey=XLYVHYXTFHZCNY-UHFFFAOYSA-N
SMILES:O=NN(CC(=O)O)CC(=O)O
- Synonyms:
- Acetic acid, nitrosiminodi-
- N-Nitrosoiminodiacetic acid
- Nitrosoiminodiacetic acid
- Glycine, N-(carboxymethyl)-N-nitroso-
- N-(Carboxymethyl)-N-nitrosoglycine
N-Nitrosoiminodiacetic acid Solution (1 mL ) (2,2'-(nitrosoazanediyl)diacetic acid)
Ref: 45-1A04070
| 1mg/ml | 671.00 € |
N-Nitrosoiminodiacetic acid (2,2'-(nitrosoazanediyl)diacetic acid)
Ref: 45-1A04400
| 10mg | 818.00 € |
Glycine, N-(carboxymethyl)-N-nitroso-
Ref: IN-DA002QFA
| Undefined size | To inquire |
Ref: 4Z-E-104006
| 5mg | To inquire | ||
| 10mg | To inquire | ||
| 25mg | To inquire | ||
| 50mg | To inquire | ||
| 100mg | To inquire |
