CAS 2510-37-4

2,4-dimethyl-1,3-oxazole-5-carboxylic acid

Description:

2,4-Dimethyl-1,3-oxazole-5-carboxylic acid is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. This compound features two methyl groups at the 2 and 4 positions of the oxazole ring and a carboxylic acid functional group at the 5 position, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. The compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activities. Its molecular structure allows for various chemical reactions, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₆H₇NO₃

InChI: InChI=1/C6H7NO3/c1-3-5(6(8)9)10-4(2)7-3/h1-2H3,(H,8,9)

SMILES: Cc1c(C(=O)O)oc(C)n1

Synonyms:

• 5-Oxazolecarboxylic Acid, 2,4-Dimethyl-

5-Oxazolecarboxylic acid, 2,4-dimethyl-

CAS: 2510-37-4

Formula: C₆H₇NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 141.1247

Ref: IN-DA002QH0

2,4-Dimethyl-1,3-oxazole-5-carboxylic acid

CAS: 2510-37-4

2,4-Dimethyl-1,3-oxazole-5-carboxylic acid

Formula: C₆H₇NO₃

Purity: ≥95%

Color and Shape: white solid

Molecular weight: 141.12g/mol

Ref: 54-OR46096

2,4-Dimethyloxazole-5-carboxylic acid

CAS: 2510-37-4

Formula: C₆H₇NO₃

Purity: 95%

Color and Shape: Beige powder

Molecular weight: 141.126

Ref: 10-F229074

2,4-Dimethyl-5-oxazolecarboxylic Acid

Controlled Product

CAS: 2510-37-4

Formula: C₆H₇NO₃

Color and Shape: Neat

Molecular weight: 141.12

Ref: TR-D476330