CAS 25103-58-6
:tert-Dodecyl mercaptan
Description:
Tert-Dodecyl mercaptan, with the CAS number 25103-58-6, is an organic compound classified as a thiol, characterized by the presence of a sulfur atom bonded to a carbon atom. It features a dodecyl group, which is a straight-chain alkyl group consisting of twelve carbon atoms, attached to a thiol functional group (-SH). This compound is typically a colorless to pale yellow liquid with a distinct odor reminiscent of sulfur. Tert-Dodecyl mercaptan is known for its role as a chain transfer agent in polymerization processes, particularly in the production of polymers like polyethylene and polystyrene, where it helps control molecular weight and improve product properties. Additionally, it exhibits good solubility in organic solvents and is relatively stable under normal conditions, although it can be sensitive to oxidation. Safety considerations include its potential to cause irritation upon contact with skin or eyes, and appropriate handling measures should be taken to minimize exposure.
Formula:C12H26S
InChI:InChI=1/C12H26S/c1-9(2)10(3,4)11(5,6)12(7,8)13/h9,13H,1-8H3
SMILES:CC(C)C(C)(C)C(C)(C)C(C)(C)S
Synonyms:- 2,3,3,4,4,5-Hexamethylhexane-2-Thiol
- Dodecanethiol, Mixed Isomers
- Sulfole 120
- Tert-dodecyl mercaptan
- t-DDM
- tert-Dodecanethiol
- tert-Dodecanethiol (mixture of isomers)
- tert-Dodecyl thiol
- tert-Lauryl mercaptan
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
tert-Dodecyl Mercaptan (mixture of isomers)
CAS:Formula:C12H26SPurity:>98.0%(T)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:202.40tert-Dodecanethiol (Mixture of Isomers)
CAS:Controlled ProductFormula:C12H26SColor and Shape:NeatMolecular weight:202.4Tert-Dodecylmercaptan (mix. of isomers) extrapure, 98.5%
CAS:Formula:C12H26SPurity:min. 98.5%Color and Shape:Clear, Colourless to almost colourless, LiquidMolecular weight:202.40





