CAS 25108-21-8: 2-(1,3-benzothiazol-2-ylmethyl)benzoate

Description: 2-(1,3-benzothiazol-2-ylmethyl)benzoate, with the CAS number 25108-21-8, is an organic compound characterized by its benzothiazole and benzoate functional groups. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of the benzothiazole moiety contributes to its biological activity, often exhibiting antimicrobial or antifungal properties. The benzoate group can influence its solubility and reactivity, making it suitable for use in different chemical reactions or formulations. Additionally, the compound may exhibit fluorescence, which can be advantageous in certain analytical applications. Its stability and reactivity can vary depending on environmental conditions such as pH and temperature. Overall, 2-(1,3-benzothiazol-2-ylmethyl)benzoate is a versatile compound with significant potential in research and industrial applications, warranting further investigation into its properties and uses.

Formula: C₁₅H₁₀NO₂S

InChI: InChI=1/C15H11NO2S/c17-15(18)11-6-2-1-5-10(11)9-14-16-12-7-3-4-8-13(12)19-14/h1-8H,9H2,(H,17,18)/p-1

2-(1,3-Benzothiazol-2-ylmethyl)benzoic acid

CAS: 25108-21-8

• Formula: C₁₅H₁₁NO₂S
• Molecular weight: 269.3183

2-(1,3-Benzothiazol-2-ylmethyl)benzoic acid

CAS: 25108-21-8

Versatile small molecule scaffold

• Formula: C₁₅H₁₁NO₂S
• Purity: Min. 95%
• Molecular weight: 269.3 g/mol