CAS 251096-79-4

α-[[(4-Chlorophenyl)sulfonyl]amino]benzeneacetic acid

Description:

α-[[(4-Chlorophenyl)sulfonyl]amino]benzeneacetic acid, with the CAS number 251096-79-4, is a chemical compound characterized by its sulfonamide functional group and an acetic acid moiety. This compound features a chlorophenyl group, which contributes to its lipophilicity and potential biological activity. The presence of the sulfonyl group enhances its solubility in polar solvents, making it suitable for various applications in medicinal chemistry. It may exhibit properties such as anti-inflammatory or analgesic effects, typical of compounds with similar structural motifs. The compound's molecular structure allows for potential interactions with biological targets, which can be explored in drug development. Additionally, its stability and reactivity can be influenced by the substituents on the aromatic rings, making it a subject of interest in synthetic organic chemistry. Overall, α-[[(4-Chlorophenyl)sulfonyl]amino]benzeneacetic acid represents a versatile scaffold for further chemical modifications and biological evaluations.

Formula: C₁₄H₁₂ClNO₄S

InChI: InChI=1S/C14H12ClNO4S/c15-11-6-8-12(9-7-11)21(19,20)16-13(14(17)18)10-4-2-1-3-5-10/h1-9,13,16H,(H,17,18)

InChI key: InChIKey=RCGHLRLGTZRRKK-UHFFFAOYSA-N

SMILES: C(NS(=O)(=O)C1=CC=C(Cl)C=C1)(C(O)=O)C2=CC=CC=C2

Synonyms:

• Benzeneacetic acid, α-[[(4-chlorophenyl)sulfonyl]amino]-
• 2-[[(4-Chlorophenyl)sulfonyl]amino]-2-phenylacetic acid
• 2-(4-Chlorobenzenesulfonamido)-2-phenylacetic acid
• α-[[(4-Chlorophenyl)sulfonyl]amino]benzeneacetic acid

2-(4-Chlorobenzenesulfonamido)-2-phenylacetic acid

CAS: 251096-79-4

Versatile small molecule scaffold

Formula: C₁₄H₁₂ClNO₄S

Purity: Min. 95%

Molecular weight: 325.8 g/mol

Ref: 3D-BKA09679