CAS 251097-15-1

2-chloro-N-[4-(pyrrolidin-1-yl)phenyl]acetamide

Description:

2-Chloro-N-[4-(pyrrolidin-1-yl)phenyl]acetamide, with the CAS number 251097-15-1, is a chemical compound characterized by its specific structural features. It contains a chloro group attached to an acetamide moiety, which is further substituted with a phenyl group that has a pyrrolidine ring. This compound is typically classified as an amide and exhibits properties associated with both aromatic and aliphatic systems due to its structural components. The presence of the pyrrolidine ring suggests potential for interactions with biological systems, making it of interest in medicinal chemistry. Its molecular structure may influence its solubility, stability, and reactivity, which are critical for applications in drug development. Additionally, the chloro substituent can enhance the compound's reactivity and may play a role in its biological activity. Overall, 2-chloro-N-[4-(pyrrolidin-1-yl)phenyl]acetamide represents a unique chemical entity with potential applications in pharmacology and organic synthesis.

Formula: C₁₂H₁₅ClN₂O

InChI: InChI=1/C12H15ClN2O/c13-9-12(16)14-10-3-5-11(6-4-10)15-7-1-2-8-15/h3-6H,1-2,7-9H2,(H,14,16)

SMILES: C1CCN(C1)c1ccc(cc1)NC(=O)CCl

Synonyms:

• 2-chloro-N-(4-pyrrolidin-1-ylphenyl)acetamide
• Acetamide, 2-chloro-N-[4-(1-pyrrolidinyl)phenyl]-
• 2-Chloro-N-[4-(pyrrolidin-1-yl)phenyl]acetamide

2-Chloro-N-(4-(pyrrolidin-1-yl)phenyl)acetamide

CAS: 251097-15-1

Formula: C₁₂H₁₅ClN₂O

Molecular weight: 238.7133

Ref: IN-DA002QII

2-Chloro-N-[4-(pyrrolidin-1-yl)phenyl]acetamide

CAS: 251097-15-1

2-Chloro-N-[4-(pyrrolidin-1-yl)phenyl]acetamide

Purity: 95%

Molecular weight: 238.71g/mol

Ref: 54-OR32041

2-Chloro-N-[4-(1-pyrrolidinyl)phenyl]acetamide

CAS: 251097-15-1

Versatile small molecule scaffold

Formula: C₁₂H₁₅ClN₂O

Purity: Min. 95%

Molecular weight: 238.72 g/mol

Ref: 3D-BKA09715