CAS 25110-61-6

3-propylhexanoic acid

Description:

3-Propylhexanoic acid, with the CAS number 25110-61-6, is a branched-chain fatty acid characterized by its aliphatic structure. It features a six-carbon chain with a propyl group attached to the third carbon, giving it unique properties compared to straight-chain fatty acids. This compound is typically a colorless to pale yellow liquid at room temperature and has a moderate boiling point, indicative of its molecular weight and structure. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. 3-Propylhexanoic acid is known for its applications in the synthesis of various esters and as an intermediate in organic synthesis. Additionally, it may exhibit mild irritant properties upon contact with skin or mucous membranes. Its fatty acid structure allows it to participate in various chemical reactions, making it useful in the production of surfactants, lubricants, and other industrial chemicals. Overall, 3-propylhexanoic acid is a versatile compound with significant relevance in both industrial and research settings.

Formula: C₉H₁₈O₂

InChI: InChI=1/C9H18O2/c1-3-5-8(6-4-2)7-9(10)11/h8H,3-7H2,1-2H3,(H,10,11)

SMILES: CCCC(CCC)CC(=O)O

Hexanoic acid, 3-propyl-

CAS: 25110-61-6

Formula: C₉H₁₈O₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 158.2380

Ref: IN-DA002QIM

3-Propylhexanoic acid

CAS: 25110-61-6

3-Propylhexanoic acid

Purity: 95%

Molecular weight: 158.24g/mol

Ref: 54-OR1049561

3-Propylhexanoic acid

CAS: 25110-61-6

Purity: 95%

Molecular weight: 158.2409973

Ref: 10-F647700

3-Propylhexanoic acid

CAS: 25110-61-6

3-Propylhexanoic acid is a teratogenic compound that has been shown to be effective against epilepsy and cytomegalovirus. It is also an inhibitor of histone deacetylases, which are enzymes that catalyze the removal of acetyl groups from lysine residues in histones. 3-Propylhexanoic acid has been shown to inhibit the enzyme activity of these enzymes, leading to increased levels of acetylation in the brain and liver. This leads to decreased transcription of genes involved in neuronal growth and differentiation and cell survival, as well as increased transcription of genes involved in apoptosis. 3-Propylhexanoic acid is a potent teratogen, causing abnormalities in fetal development when administered during pregnancy.

Formula: C₉H₁₈O₂

Purity: Min. 95%

Molecular weight: 158.24 g/mol

Ref: 3D-ABA11061