CAS 251101-36-7
:3-Methyl-4-pyridinecarboxamide
Description:
3-Methyl-4-pyridinecarboxamide, with the CAS number 251101-36-7, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methyl group and a carboxamide functional group attached to the pyridine ring, influencing its chemical reactivity and properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxamide group, which can engage in hydrogen bonding. The compound may be used in various applications, including pharmaceuticals and agrochemicals, owing to its potential biological activity. Its molecular structure allows for interactions with biological targets, making it of interest in medicinal chemistry. As with many nitrogen-containing heterocycles, it may exhibit basic properties, and its derivatives can be synthesized for further research and development. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H8N2O
InChI:InChI=1/C7H8N2O/c1-5-4-9-3-2-6(5)7(8)10/h2-4H,1H3,(H2,8,10)
SMILES:Cc1cnccc1C(=O)N
Synonyms:- 3-Methylpyridine-4-Carboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Pyridinecarboxamide, 3-methyl-
CAS:Formula:C7H8N2OPurity:97%Color and Shape:SolidMolecular weight:136.15123-Methylisonicotinamide
CAS:<p>3-Methylisonicotinamide is an immune-related drug that belongs to the class of heterocyclic compounds. It is an innovative therapeutic agent for inflammatory diseases and cancer. 3-Methylisonicotinamide has been shown to inhibit the production of inflammatory cytokines, chemokines, and prostaglandins. This compound also blocks the production of reactive oxygen species by inhibiting the activation of NADPH oxidase in neutrophils and macrophages. The inhibition of reactive oxygen species prevents cytotoxicity and cell death in vitro. 3-Methylisonicotinamide binds to nuclear receptor subtypes (e.g., PPARγ) that are involved in inflammation, cancer, and neuropathic pain with high affinity. These receptors are located on the surface of cells where they regulate cellular functions such as proliferation, differentiation, and apoptosis.</p>Formula:C7H8N2OPurity:Min. 95%Molecular weight:136.15 g/mol



