CymitQuimica logo

CAS 251102-28-0

:

Pyrrolo[1,2-c]pyrimidine-3-carboxaldehyde

Description:
Pyrrolo[1,2-c]pyrimidine-3-carboxaldehyde is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings, which contribute to its unique chemical properties. This compound features a carboxaldehyde functional group, which is known for its reactivity, particularly in condensation reactions and as a precursor in various synthetic pathways. The presence of nitrogen atoms in the ring structure enhances its potential for forming coordination complexes with metals and participating in biological activities. Pyrrolo[1,2-c]pyrimidine derivatives are of interest in medicinal chemistry due to their potential as pharmacological agents, including antitumor and antiviral properties. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents. Its reactivity and structural features make it a valuable intermediate in organic synthesis, particularly in the development of novel pharmaceuticals and agrochemicals. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C8H6N2O
InChI:InChI=1S/C8H6N2O/c11-5-7-4-8-2-1-3-10(8)6-9-7/h1-6H
InChI key:InChIKey=FSUFULJJNXRMNE-UHFFFAOYSA-N
SMILES:C(=O)C1=CC=2N(C=N1)C=CC2
Synonyms:
  • Pyrrolo[1,2-c]pyrimidine-3-carboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.