CymitQuimica logo

CAS 251107-41-2

:

1H-Indole-5-carboxylic acid, 4-chloro-

Description:
1H-Indole-5-carboxylic acid, 4-chloro- is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a carboxylic acid group (-COOH) at the 5-position and a chlorine atom at the 4-position of the indole ring contributes to its chemical reactivity and potential biological activity. This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the carboxylic acid functionality. It may exhibit acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The chlorine substituent can influence the compound's electronic properties and steric effects, potentially affecting its interactions with biological targets. 1H-Indole-5-carboxylic acid, 4-chloro- is of interest in medicinal chemistry and research due to its structural similarity to various bioactive compounds, making it a candidate for further studies in drug development and synthesis.
Formula:C9H6ClNO2
InChI:InChI=1S/C9H6ClNO2/c10-8-5-3-4-11-7(5)2-1-6(8)9(12)13/h1-4,11H,(H,12,13)
InChI key:YYRDZTXRLMYLQY-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=CN2)C(=C1C(=O)O)Cl
Found 1 products.