CAS 25116-37-4
:(3-iodophenyl)(phenyl)methanone
Description:
(3-Iodophenyl)(phenyl)methanone, with the CAS number 25116-37-4, is an organic compound characterized by the presence of both a phenyl group and a 3-iodophenyl group attached to a carbonyl (C=O) functional group. This compound features a ketone structure, where the carbonyl carbon is bonded to two aromatic rings. The iodine atom on the 3-position of the phenyl ring introduces unique electronic and steric properties, which can influence the compound's reactivity and interactions in various chemical environments. Typically, such compounds exhibit moderate to high lipophilicity due to their aromatic nature, which can affect their solubility in organic solvents. Additionally, the presence of the iodine atom may enhance the compound's potential for electrophilic substitution reactions. This compound may be of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, where halogenated aromatic compounds often play a crucial role in biological activity. Safety and handling precautions should be observed due to the potential hazards associated with iodine-containing compounds.
Formula:C13H9IO
InChI:InChI=1/C13H9IO/c14-12-8-4-7-11(9-12)13(15)10-5-2-1-3-6-10/h1-9H
SMILES:c1ccc(cc1)C(=O)c1cccc(c1)I
Synonyms:- 3-Iodobenzophenone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(3-Iodophenyl)(phenyl)methanone
CAS:<p>3-Iodophenyl)(phenyl)methanone is an organic compound that contains a diaryl ketone group. It has been shown to be electrochromic and reacts with the isophthalates, which are used as plasticizers in polyvinyl chloride. 3-Iodophenyl)(phenyl)methanone has also been shown to react with organic peroxides, such as benzoyl peroxide. The radical formed by this reaction can be used in organic synthesis reactions.</p>Formula:C13H9IOPurity:Min. 95%Molecular weight:308.11 g/mol
