CAS 2512-24-5
:N-(1,1-Dimethylethyl)benzenesulfonamide
Description:
N-(1,1-Dimethylethyl)benzenesulfonamide, also known by its CAS number 2512-24-5, is an organic compound characterized by the presence of a sulfonamide functional group attached to a benzene ring, with a tert-butyl group (1,1-dimethylethyl) as a substituent. This compound typically appears as a solid at room temperature and is soluble in organic solvents, but its solubility in water is limited due to the hydrophobic nature of the tert-butyl group. The sulfonamide moiety contributes to its potential as a pharmaceutical intermediate or in agrochemical applications, as sulfonamides are known for their antibacterial properties. The presence of the bulky tert-butyl group can influence the compound's steric properties, potentially affecting its reactivity and interactions with biological targets. Additionally, N-(1,1-Dimethylethyl)benzenesulfonamide may exhibit moderate stability under standard conditions, but like many sulfonamides, it may be sensitive to hydrolysis under extreme pH conditions. Safety data should be consulted for handling and exposure guidelines.
Formula:C10H15NO2S
InChI:InChI=1/C10H15NO2S/c1-10(2,3)11-14(12,13)9-7-5-4-6-8-9/h4-8,11H,1-3H3
InChI key:InChIKey=FFUBXANSXRGVKW-UHFFFAOYSA-N
SMILES:S(NC(C)(C)C)(=O)(=O)C1=CC=CC=C1
Synonyms:- Benzenesulfonamide, N-tert-butyl-
- N-(1,1-Dimethylethyl)benzenesulfonamide
- NSC 230371
- benzenesulfonamide, N-(1,1-dimethylethyl)-
- tert-Butyl(phenylsulfonyl)amine
- tert-Butylaminosulfonylbenzene
- N-tert-Butylbenzenesulfonamide
- N-tert-Butylbenzenesulfonamide
- N-(tert-Butyl)benzenesulphonamide
- N-tert-butylbenzenesulfonamide USP/EP/BP
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzenesulfonamide, N-(1,1-dimethylethyl)-
CAS:Formula:C10H15NO2SPurity:96%Color and Shape:SolidMolecular weight:213.2966Ref: IN-DA002QK6
100mg24.00€250mg28.00€1g33.00€5g63.00€10g120.00€25g163.00€50g307.00€100g560.00€75g607.00€N-(tert-Butyl)benzenesulphonamide
CAS:N-(tert-Butyl)benzenesulphonamideFormula:C10H15NO2SPurity:98%Color and Shape: white solidMolecular weight:213.30g/molN-Tert-butylbenzenesulfonamide
CAS:N-Tert-butylbenzenesulfonamide is a sulfonamide that reacts with an azide to form a five-membered ring. This reaction is known as the aziridination reaction. N-Tert-butylbenzenesulfonamide is insoluble in water and has a molecular weight of 200 g/mol. It is used in polymerase chain reactions, which are experiments where the enzyme DNA polymerase replicates the DNA molecule by adding nucleotides to each end of the strand. N-Tert-butylbenzenesulfonamide has been shown to inhibit RNA polymerase activity and cellular growth in vitro. This agent also inhibits protein synthesis by interfering with the binding of tRNA molecules to ribosomes, preventing amino acids from being incorporated into proteins.
Formula:C10H15NO2SPurity:Min. 95%Molecular weight:213.3 g/mol



