CymitQuimica logo

CAS 25121-88-4

:

2,3,5-Tribromothieno[3,2-b]thiophene

Description:
2,3,5-Tribromothieno[3,2-b]thiophene is a polycyclic aromatic compound characterized by its unique fused ring structure, which includes both thiophene and thieno moieties. This compound features three bromine substituents at the 2, 3, and 5 positions of the thieno ring, significantly influencing its chemical properties and reactivity. The presence of bromine atoms enhances its electron-withdrawing characteristics, making it useful in various applications, including organic electronics and materials science. The compound is typically insoluble in water but may dissolve in organic solvents, reflecting its hydrophobic nature. Its synthesis often involves halogenation reactions, and it can be utilized in the development of organic semiconductors due to its potential for charge transport. Additionally, the compound's structural features may impart interesting optical properties, making it a candidate for studies in photonics and optoelectronics. Overall, 2,3,5-Tribromothieno[3,2-b]thiophene is a notable compound in the field of organic chemistry, particularly for its applications in advanced materials.
Formula:C6HBr3S2
InChI:InChI=1S/C6HBr3S2/c7-3-1-2-5(11-3)4(8)6(9)10-2/h1H
InChI key:InChIKey=JFYOKEVNMWXDNQ-UHFFFAOYSA-N
SMILES:BrC=1C2=C(SC1Br)C=C(Br)S2
Synonyms:
  • 2,3,5-Tribromothieno[3,2-b]thiophene
  • 2,5,6-Tribromothieno[3,2-b]thiophene
  • Thieno[3,2-b]thiophene, 2,3,5-tribromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.