CAS 25122-41-2: Clobetasol
Description:Clobetasol is a potent synthetic corticosteroid primarily used for its anti-inflammatory and immunosuppressive properties. It is characterized by its high affinity for glucocorticoid receptors, which allows it to effectively reduce inflammation and suppress immune responses. Clobetasol is commonly formulated as a topical medication, often found in creams, ointments, and lotions, and is indicated for various dermatological conditions, including psoriasis and eczema. Its chemical structure features a steroid backbone with specific functional groups that enhance its activity and stability. Clobetasol is typically applied in low doses due to its potency, and prolonged use can lead to side effects such as skin thinning or systemic absorption. The substance is classified under the category of corticosteroids and is recognized for its efficacy in managing severe skin disorders. As with all medications, it is essential to use clobetasol under medical supervision to mitigate potential adverse effects and ensure appropriate therapeutic outcomes.
Formula:C22H28ClFO4
InChI:InChI=1S/C22H28ClFO4/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,24)17(26)10-20(16,3)22(12,28)18(27)11-23/h6-7,9,12,15-17,26,28H,4-5,8,10-11H2,1-3H3/t12-,15-,16-,17-,19-,20-,21-,22-/m0/s1
InChI key:InChIKey=FCSHDIVRCWTZOX-DVTGEIKXSA-N
SMILES:O=C1C=CC2(C(=C1)CCC3C4CC(C)C(O)(C(=O)CCl)C4(C)CC(O)C32F)C
- Synonyms:
- (11Beta,16Beta)-21-Chloro-9-Fluoro-11,17-Dihydroxy-16-Methylpregna-1,4-Diene-3,20-Dione
- (11β,16β)-21-Chloro-9-fluoro-11,17-dihydroxy-16-methylpregna-1,4-diene-3,20-dione
- 17-(2-Chloroacetyl)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8, 11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one
- 21-Chloro-9-fluoro-11β,17-dihydroxy-16β-methylpregna-1,4-diene-3,20-dione
- Dovate
- Pregna-1,4-diene-3,20-dione, 21-chloro-9-fluoro-11,17-dihydroxy-16-methyl-, (11β,16β)-
- Pregna-1,4-diene-3,20-dione, 21-chloro-9-fluoro-11β,17-dihydroxy-16β-methyl-
