CAS 25128-32-9
:2,3-dioxo-2,3-dihydro-1H-indole-5-carboxylic acid
Description:
2,3-Dioxo-2,3-dihydro-1H-indole-5-carboxylic acid, with the CAS number 25128-32-9, is a chemical compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features two carbonyl groups (dioxo) and a carboxylic acid functional group, which contribute to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in medicinal chemistry and organic synthesis, as derivatives of indole are known for their diverse pharmacological properties, including anti-inflammatory and anticancer activities. Its unique structure allows for various chemical modifications, which can enhance its biological efficacy or alter its physical properties. Safety data and handling precautions should be observed, as with any chemical substance, to ensure proper laboratory practices.
Formula:C9H5NO4
InChI:InChI=1/C9H5NO4/c11-7-5-3-4(9(13)14)1-2-6(5)10-8(7)12/h1-3H,(H,13,14)(H,10,11,12)
SMILES:c1cc2c(cc1C(=O)O)C(=O)C(=O)N2
Synonyms:- 1H-Indole-5-carboxylic acid, 2,3-dihydro-2,3-dioxo-
- 2,3-Dioxoindoline-5-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,3-Dioxoindoline-5-carboxylic acid
CAS:Formula:C9H5NO4Purity:98%Color and Shape:SolidMolecular weight:191.1421H-Indole-5-carboxylic acid, 2,3-dihydro-2,3-dioxo-
CAS:Formula:C9H5NO4Purity:98%Color and Shape:SolidMolecular weight:191.14032,3-Dioxoindoline-5-carboxylic acid
CAS:2,3-Dioxoindoline-5-carboxylic acidPurity:98%Molecular weight:191.14g/mol2,3-Dioxoindoline-5-carboxylic acid
CAS:<p>2,3-Dioxoindoline-5-carboxylic acid (2,3-DIAC) is a carboxylic acid that has been found in plants. It can be used as a building block for the synthesis of indole compounds. 2,3-DIAC is an important intermediate in organic chemistry and has been used as a starting material for the synthesis of many other carboxylic acids.</p>Formula:C9H5NO4Purity:Min. 95%Molecular weight:191.14 g/mol



