CAS 2513-33-9
:2-(2,4-dihydroxybenzoyl)benzoic acid
Description:
2-(2,4-Dihydroxybenzoyl)benzoic acid, with the CAS number 2513-33-9, is an organic compound characterized by its aromatic structure and the presence of multiple functional groups. It features a benzoic acid moiety, which contributes to its acidic properties, and a 2,4-dihydroxybenzoyl group that enhances its potential for hydrogen bonding and reactivity. This compound is typically a solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic aromatic characteristics. The presence of hydroxyl groups in the structure allows for increased polarity, which can influence its solubility in various solvents. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its structural features suggest potential applications in areas such as drug development, where its ability to interact with biological targets could be explored. Overall, 2-(2,4-dihydroxybenzoyl)benzoic acid is a versatile compound with significant implications in both chemical and biological contexts.
Formula:C14H10O5
InChI:InChI=1/C14H10O5/c15-8-5-6-11(12(16)7-8)13(17)9-3-1-2-4-10(9)14(18)19/h1-7,15-16H,(H,18,19)
SMILES:c1ccc(c(c1)C(=O)c1ccc(cc1O)O)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Fluorescein Related Compound C (2-(2,4-Dihydroxybenzoyl)benzoic acid)
CAS:Carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides etc, nesoiFormula:C14H10O5Color and Shape:Off-White Pale Yellow PowderMolecular weight:258.05282Benzoic acid, 2-(2,4-dihydroxybenzoyl)-
CAS:Formula:C14H10O5Purity:98%Color and Shape:SolidMolecular weight:258.22622-(2,4-Dihydroxybenzoyl)benzoic acid
CAS:2-(2,4-Dihydroxybenzoyl)benzoic acidPurity:99%Molecular weight:258.23g/molFluorescein EP Impurity C (Fluorescein USP Related Compound C)
CAS:Formula:C14H10O5Molecular weight:258.232-(2,4-Dihydroxybenzoyl)benzoic Acid
CAS:Controlled ProductFormula:C14H10O5Color and Shape:NeatMolecular weight:258.232',4'-Dihydroxy-2-benzoylbenzoic Acid
CAS:Controlled ProductApplications A by-product of Fluorescein.
References Ames, B., et al.: Mutation Res., 31, 347 (1975),Formula:C14H10O5Color and Shape:Light Yellow To BrownMolecular weight:258.23









