CAS 251303-04-5

(2R)-2-[4-(9-bromo-2,3-dimethylnaphtho[2,3-b]thiophen-4-yl)-2,6-dimethylphenoxy]-3-phenylpropanoic acid

Description:

The chemical substance known as (2R)-2-[4-(9-bromo-2,3-dimethylnaphtho[2,3-b]thiophen-4-yl)-2,6-dimethylphenoxy]-3-phenylpropanoic acid, with the CAS number 251303-04-5, is a complex organic compound characterized by its multi-ring structure and various functional groups. It features a chiral center, indicating that it exists in two enantiomeric forms, which can exhibit different biological activities. The presence of a bromine atom suggests potential reactivity and influences its physical properties, such as solubility and stability. The compound contains aromatic rings, which typically contribute to its electronic properties and interactions with biological systems. Additionally, the carboxylic acid functional group is likely to impart acidic characteristics, affecting its behavior in different pH environments. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural complexity and potential biological activity. Its synthesis and characterization would require advanced organic chemistry techniques to confirm its purity and structural integrity.

Formula: C₃₁H₂₇BrO₃S

InChI: InChI=1/C31H27BrO3S/c1-17-14-22(15-18(2)29(17)35-25(31(33)34)16-21-10-6-5-7-11-21)27-23-12-8-9-13-24(23)28(32)30-26(27)19(3)20(4)36-30/h5-15,25H,16H2,1-4H3,(H,33,34)/t25-/m1/s1

SMILES: Cc1cc(cc(C)c1O[C@H](Cc1ccccc1)C(=O)O)c1c2ccccc2c(c2c1c(C)c(C)s2)Br

Synonyms:

• benzenepropanoic acid, alpha-[4-(9-bromo-2,3-dimethylnaphtho[2,3-b]thien-4-yl)-2,6-dimethylphenoxy]-, (alphaR)-

Ertiprotafib

CAS: 251303-04-5

Ertiprotafib

Purity: ≥98%

Molecular weight: 559.51g/mol

Ref: 54-BUP08491

Ertiprotafib

Controlled Product

CAS: 251303-04-5

Formula: C₃₁H₂₇BrO₃S

Color and Shape: Neat

Molecular weight: 559.513

Ref: TR-E635085

Ertiprotafib

CAS: 251303-04-5

Ertiprotafib is a natural drug that inhibits the activity of enzymes involved in the synthesis of fatty acids and proteins. Ertiprotafib has been shown to inhibit phosphatase, acetylcholinesterase, hydroxylase, and phosphodiesterase. The inhibition of these enzymes leads to an increase in messenger RNA levels and protein production by cells. This drug also has anti-cancer properties. Clinical studies have shown that Ertiprotafib improves diabetic patients’ glucose tolerance and reduces insulin resistance.

Formula: C₃₁H₂₇BrO₃S

Purity: Min. 95%

Molecular weight: 559.5 g/mol

Ref: 3D-BKA30304

Ertiprotafib

CAS: 251303-04-5

Ertiprotafib (PTP 112), a PTP1B and IKK-β inhibitor, is a novel insulin sensitizer for the study of type 2 diabetes and breast cancer.

Formula: C₃₁H₂₇BrO₃S

Purity: 98.70%

Color and Shape: Solid

Molecular weight: 559.51

Ref: TM-T15243