CAS 251310-43-7

4-Hydroxy-1-(2-thienylsulfonyl)proline

Description:

4-Hydroxy-1-(2-thienylsulfonyl)proline, with the CAS number 251310-43-7, is an organic compound characterized by its unique structural features, including a proline backbone modified with a hydroxyl group and a thienylsulfonyl substituent. This compound typically exhibits properties associated with amino acids, such as the ability to participate in hydrogen bonding due to the hydroxyl group. The presence of the thienylsulfonyl moiety may impart additional chemical reactivity and influence its solubility and stability in various solvents. As a proline derivative, it may also exhibit specific conformational preferences that can affect its biological activity. Compounds like this are often studied for their potential applications in pharmaceuticals, particularly in the development of inhibitors or modulators of biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and its behavior in biological systems would be of interest for medicinal chemistry research.

Formula: C₉H₁₁NO₅S₂

InChI: InChI=1S/C9H11NO5S2/c11-6-4-7(9(12)13)10(5-6)17(14,15)8-2-1-3-16-8/h1-3,6-7,11H,4-5H2,(H,12,13)

InChI key: InChIKey=GPQQYSLEPAAZBE-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1C(C(O)=O)CC(O)C1)C2=CC=CS2