CymitQuimica logo

CAS 251317-00-7

:

3-Amino-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-alanine

Description:
3-Amino-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-alanine, commonly referred to as Fmoc-D-Ala-OH, is a derivative of the amino acid D-alanine that features a fluorenylmethoxycarbonyl (Fmoc) protecting group. This compound is characterized by its structural components, which include an amino group (-NH2), a carboxylic acid group (-COOH), and the Fmoc group that serves as a protective moiety for the amino group during peptide synthesis. The Fmoc group is known for its stability under basic conditions and can be removed under mild acidic conditions, making it a popular choice in solid-phase peptide synthesis. The presence of the fluorenyl group contributes to the compound's hydrophobic characteristics, influencing its solubility and interaction with other molecules. Additionally, the D-alanine configuration is significant in the context of peptide synthesis, as it can affect the biological activity and conformation of the resulting peptides. Overall, this compound is valuable in the field of organic chemistry and biochemistry, particularly in the synthesis of peptides and related compounds.
Formula:C18H18N2O4
InChI:InChI=1S/C18H18N2O4/c19-9-16(17(21)22)20-18(23)24-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16H,9-10,19H2,(H,20,23)(H,21,22)/t16-/m1/s1
InChI key:InChIKey=HDSLKWZYHRLRRL-MRXNPFEDSA-N
SMILES:C(OC(N[C@@H](C(O)=O)CN)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2
Synonyms:
  • (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-aminopropanoicacid
  • 3-Amino-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-alanine
  • D-Alanine, 3-amino-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-
Found 4 products.