
CAS 25134-45-6
:Carbonic dichloride, polymer with 4,4′-cyclohexylidenebis[phenol]
Description:
Carbonic dichloride, polymer with 4,4′-cyclohexylidenebis[phenol], commonly known by its CAS number 25134-45-6, is a type of polymer that exhibits unique characteristics due to its structural composition. This substance is a thermosetting polymer, which means it undergoes a chemical change when heated, resulting in a rigid and infusible material. It is known for its excellent thermal stability, mechanical strength, and resistance to chemicals, making it suitable for various industrial applications. The presence of the 4,4′-cyclohexylidenebis[phenol] moiety contributes to its enhanced rigidity and durability. Additionally, this polymer typically exhibits low moisture absorption and good dimensional stability, which are critical for applications in environments where moisture and temperature fluctuations are prevalent. Its processing can involve techniques such as molding or extrusion, and it is often utilized in the production of coatings, adhesives, and composite materials. Overall, this polymer's unique properties make it valuable in sectors such as automotive, aerospace, and electronics.
Formula:(C18H20O2·CCl2O)x
InChI:InChI=1S/C18H20O2.CCl2O/c19-16-8-4-14(5-9-16)18(12-2-1-3-13-18)15-6-10-17(20)11-7-15;2-1(3)4/h4-11,19-20H,1-3,12-13H2;
InChI key:InChIKey=XQUZRQFWXVAERD-UHFFFAOYSA-N
SMILES:OC1=CC=C(C2(CCCCC2)C3=CC=C(O)C=C3)C=C1.C(Cl)(Cl)=O
Synonyms:- 1,1-Bis(4-hydroxyphenyl)cyclohexane-phosgene copolymer
- 1,1-Bis(4-hydroxyphenyl)cyclohexane-phosgene polymer
- 1,1-Bis(p-hydroxyphenyl)cyclohexane-phosgene polymer
- 4,4′-Cyclohexylidenediphenol-phosgene polymer
- Bis(4-hydroxyphenyl)cyclohexane-phosgene copolymer
- Bisphenol Z-phosgene copolymer
- Carbonic dichloride, polymer with 4,4'-cyclohexylidenebis[phenol]
- Carbonic dichloride-4,4′-cyclohexylidenebis phenol copolymer
- Phenol, 4,4′-cyclohexylidenebis-, polymer with carbonic dichloride
- Phenol, 4,4′-cyclohexylidenedi-, polyester with phosgene
- Phosgene, polyester with 4,4′-cyclohexylidenediphenol
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Bisphenol Z-d8-Phosgene Copolymer
CAS:Controlled ProductApplications Bisphenol Z-d8-Phosgene Copolymer is the labeled analogue of Bisphenol Z-Phosgene Copolymer (B519660), an aromatic polycarbonate that is use to create lenses that shows good heat resistance, high refractive index, and high transparency.
Formula:C21H16D8O3nHClnColor and Shape:NeatMolecular weight:368.92 * nBisphenol Z-Phosgene Copolymer
CAS:Controlled ProductFormula:(C21H24O3)n·HClColor and Shape:NeatMolecular weight:360.87 * n
