
CAS 25134-54-7
:Ethylene-dimethylaminoethyl methacrylate copolymer
Description:
Ethylene-dimethylaminoethyl methacrylate copolymer, identified by its CAS number 25134-54-7, is a synthetic polymer that exhibits a range of characteristics making it useful in various applications. This copolymer is formed from the polymerization of ethylene and dimethylaminoethyl methacrylate, resulting in a material that combines the properties of both components. It is typically characterized by its good adhesion, flexibility, and resistance to environmental factors, which makes it suitable for use in coatings, adhesives, and sealants. The presence of dimethylamino groups imparts cationic properties, allowing for interactions with anionic species, which can enhance its performance in certain formulations. Additionally, this copolymer can be modified to achieve desired solubility and viscosity characteristics, making it versatile for applications in pharmaceuticals, cosmetics, and other industrial products. Its biocompatibility and ability to form films further expand its utility in biomedical applications. Overall, ethylene-dimethylaminoethyl methacrylate copolymer is valued for its multifunctional properties and adaptability in various chemical environments.
Formula:(C8H15NO2·C2H4)x
InChI:InChI=1S/C8H15NO2.C2H4/c1-7(2)8(10)11-6-5-9(3)4;1-2/h1,5-6H2,2-4H3;1-2H2
InChI key:InChIKey=PNMYDOBPCBCQIA-UHFFFAOYSA-N
SMILES:O(C(C(C)=C)=O)CCN(C)C.C=C
Synonyms:- Ethylene, polymer with 2-(dimethylamino)ethyl methacrylate
- Ethylene-2-(dimethylamino)ethyl methacrylate copolymer
- Methacrylic acid, 2-(dimethylamino)ethyl ester, polymer with ethylene
- 2-Propenoic acid, 2-methyl-, 2-(dimethylamino)ethyl ester, polymer with ethene
- Ethene, polymer with 2-(dimethylamino)ethyl 2-methyl-2-propenoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
F 522
CAS:F 522 (DA-3031) is a long-lasting recombinant granulocytic colony-stimulating factor aimed at preventing breast cancer.Formula:C10H19NO2Color and Shape:SolidMolecular weight:185.26
