CAS 25135-15-3
:Anthracene, homopolymer
Description:
Anthracene homopolymer, identified by CAS number 25135-15-3, is a polymer derived from the polymerization of anthracene, a polycyclic aromatic hydrocarbon. This substance typically exhibits a high degree of thermal stability and is characterized by its crystalline structure, which contributes to its rigidity and strength. Anthracene homopolymer is generally insoluble in water and exhibits solubility in organic solvents such as benzene and toluene. Its optical properties include strong absorption in the ultraviolet and visible regions, making it useful in applications such as organic electronics and photonic devices. The polymer's electrical conductivity can vary depending on its processing and the presence of dopants, which can enhance its performance in electronic applications. Additionally, anthracene homopolymer is known for its potential use in the production of light-emitting diodes (LEDs) and other optoelectronic materials. However, handling precautions are necessary due to the potential toxicity of anthracene and its derivatives.
Formula:(C14H10)x
InChI:InChI=1S/C14H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-10H
InChI key:InChIKey=MWPLVEDNUUSJAV-UHFFFAOYSA-N
SMILES:C12=C(C=C3C(=C1)C=CC=C3)C=CC=C2
Synonyms:- Anthracene, polymers
- Anthracene polymer
- Anthracene, homopolymer
- Anthracene oligomer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
