CAS 25136-77-0
:4-Aminobenzoic acid homopolymer
Description:
4-Aminobenzoic acid homopolymer, identified by CAS number 25136-77-0, is a synthetic polymer derived from the polymerization of 4-aminobenzoic acid monomers. This compound exhibits characteristics typical of polyamides, including good thermal stability and mechanical strength. It is soluble in polar solvents and can form hydrogen bonds due to the presence of amino and carboxylic acid functional groups, which also contribute to its potential applications in biocompatible materials. The polymer's structure allows for various modifications, enhancing its utility in fields such as drug delivery, tissue engineering, and as a precursor for other chemical syntheses. Additionally, 4-aminobenzoic acid homopolymer can exhibit UV-absorbing properties, making it useful in cosmetic formulations and sunscreens. Its biocompatibility and biodegradability are significant advantages for applications in biomedical fields. Overall, this polymer's unique properties stem from its functional groups and structural characteristics, making it a versatile material in both industrial and research settings.
Formula:(C7H7NO2)x
InChI:InChI=1S/C7H7NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H,9,10)
InChI key:InChIKey=ALYNCZNDIQEVRV-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(N)C=C1
Synonyms:- Benzoic acid, p-amino-, polyamides
- Poly(p-aminobenzoic acid)
- Benzoic acid, 4-amino-, homopolymer
- 4-Aminobenzoic acid polymer
- p-Aminobenzoic acid polymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
