CAS 25141-45-1

(2-benzylphenoxy)acetate

Description:

(2-benzylphenoxy)acetate, with the CAS number 25141-45-1, is an organic compound that belongs to the class of esters. It is characterized by the presence of a benzyl group and a phenoxy group attached to an acetate moiety. This compound typically exhibits a moderate to high degree of lipophilicity, which can influence its solubility in organic solvents and its behavior in biological systems. The presence of aromatic rings contributes to its stability and potential for engaging in π-π interactions. (2-benzylphenoxy)acetate may be utilized in various applications, including as an intermediate in organic synthesis or in the formulation of certain chemical products. Its chemical structure suggests potential reactivity, particularly in nucleophilic substitution reactions, and it may also exhibit specific biological activities, although detailed studies would be necessary to elucidate its full range of properties and applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₁₅H₁₃O₃

InChI: InChI=1/C15H14O3/c16-15(17)11-18-14-9-5-4-8-13(14)10-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,16,17)/p-1

SMILES: c1ccc(cc1)Cc1ccccc1OCC(=O)[O-]

2-(2-Benzylphenoxy)acetic acid

CAS: 25141-45-1

Formula: C₁₅H₁₄O₃

Molecular weight: 242.2699

Ref: IN-DA002QLT

2-(2-Benzylphenoxy)acetic acid

CAS: 25141-45-1

Versatile small molecule scaffold

Formula: C₁₅H₁₄O₃

Purity: Min. 95%

Molecular weight: 242.27 g/mol

Ref: 3D-ABA14145