CymitQuimica logo

CAS 25144-05-2

:

cis-2-Methylcyclopentanol

Description:
Cis-2-Methylcyclopentanol is a cyclic alcohol characterized by its unique structure, which includes a cyclopentane ring with a methyl group and a hydroxyl group positioned on adjacent carbon atoms. This configuration leads to specific stereochemical properties, as the "cis" designation indicates that the hydroxyl and methyl groups are on the same side of the ring. The compound is typically a colorless liquid at room temperature and exhibits moderate solubility in water due to the presence of the hydroxyl group, which can engage in hydrogen bonding. Its molecular formula reflects the presence of carbon, hydrogen, and oxygen, contributing to its classification as an alcohol. Cis-2-Methylcyclopentanol is of interest in organic synthesis and may serve as an intermediate in the production of various chemical compounds. Additionally, its physical properties, such as boiling point and density, can be influenced by the presence of the hydroxyl group and the cyclic structure, making it relevant in both industrial and research applications.
Formula:C6H12O
InChI:InChI=1/C6H12O/c1-5-3-2-4-6(5)7/h5-7H,2-4H2,1H3/t5-,6+/s2
InChI key:InChIKey=BVIJQMCYYASIFP-MZQZIECVNA-N
SMILES:C[C@H]1[C@@H](O)CCC1
Synonyms:
  • (?à)-cis-2-Methylcyclopentanol
  • Cyclopentanol, 2-methyl-, cis-
  • Cyclopentanol,2-methyl-, cis- (8CI)
  • cis-2-Methylcyclopentanol
  • rel-(1R,2S)-2-Methylcyclopentanol
  • Cyclopentanol, 2-methyl-, (1R,2S)-rel-
Found 3 products.