CAS 25150-27-0
:6,7-Dichloro-2-benzothiazolamine
Description:
6,7-Dichloro-2-benzothiazolamine is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound features two chlorine substituents at the 6 and 7 positions of the benzothiazole moiety, contributing to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the amine functional group suggests that it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications as a building block in the synthesis of more complex molecules. Additionally, its chlorinated structure may impart specific properties such as increased stability or altered biological activity. Safety data should be consulted for handling and exposure, as halogenated compounds can pose environmental and health risks.
Formula:C7H4Cl2N2S
InChI:InChI=1S/C7H4Cl2N2S/c8-3-1-2-4-6(5(3)9)12-7(10)11-4/h1-2H,(H2,10,11)
InChI key:InChIKey=YKHFWFMWXBZUHK-UHFFFAOYSA-N
SMILES:ClC1=C2C(N=C(N)S2)=CC=C1Cl
Synonyms:- Benzothiazole, 2-amino-6,7-dichloro-
- 2-Amino-6,7-dichlorobenzothiazole
- 6,7-Dichlorobenzothiazol-2-amine
- 2-Benzothiazolamine, 6,7-dichloro-
- 6,7-Dichloro-2-benzothiazolamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Benzothiazolamine, 6,7-dichloro-
CAS:Formula:C7H4Cl2N2SPurity:97%Color and Shape:SolidMolecular weight:219.09116,7-Dichlorobenzo[d]thiazol-2-amine
CAS:6,7-Dichlorobenzo[d]thiazol-2-aminePurity:99%Molecular weight:219.09g/mol2-Amino-5,6-dichlorobenzothiazole
CAS:2-Amino-5,6-dichlorobenzothiazole is an aminobenzothiazole derivative that has been shown to have antibacterial activity. It is a hydrophobic molecule with a skeleton consisting of alternating amines and carboxylic acids. 2-Amino-5,6-dichlorobenzothiazole binds to the fatty acid ester component of bacterial cell walls by hydrogen bonding or ionic interactions, disrupting the integrity of the cell wall and inhibiting the growth of bacteria. 2-Amino-5,6-dichlorobenzothiazole can be used to decolorize dyes and textiles that have been stained by oily materials. It is also used as a surfactant in personal care products such as shampoos and conditioners.
Formula:C7H4Cl2N2SPurity:Min. 95%Molecular weight:219.09 g/mol



