CAS 25151-07-9

5-Chloro-2,4-difluoropyrimidine

Description:

5-Chloro-2,4-difluoropyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of chlorine and fluorine substituents at the 5, 2, and 4 positions, respectively, contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It exhibits moderate polarity due to the electronegative halogen atoms, which can influence its reactivity and solubility in various solvents. 5-Chloro-2,4-difluoropyrimidine is often utilized in pharmaceutical and agrochemical research, serving as an intermediate in the synthesis of biologically active compounds. Its reactivity can be attributed to the presence of the halogen substituents, which can participate in nucleophilic substitution reactions. Additionally, the compound's stability and behavior under different conditions make it a subject of interest in synthetic organic chemistry.

Formula: C₄HClF₂N₂

InChI: InChI=1/C4HClF2N2/c5-2-1-8-4(7)9-3(2)6/h1H

SMILES: c1c(c(F)nc(F)n1)Cl

Pyrimidine, 5-chloro-2,4-difluoro-

CAS: 25151-07-9

Formula: C₄HClF₂N₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 150.5139

Ref: IN-DA002QO1

5-Chloro-2,4-difluoropyrimidine

CAS: 25151-07-9

5-Chloro-2,4-difluoropyrimidine

Formula: C₄HClF₂N₂

Purity: 98%

Color and Shape: colourless liquid

Molecular weight: 150.51g/mol

Ref: 54-PC99062

5-Chloro-2,4-difluoropyrimidine

CAS: 25151-07-9

Purity: 98%

Molecular weight: 150.5099945

Ref: 10-F692277

5-Chloro-2,4-difluoropyrimidine

Controlled Product

CAS: 25151-07-9

Formula: C₄HClF₂N₂

Color and Shape: Neat

Molecular weight: 150.514

Ref: TR-C365805