CAS 25151-81-9
:Prostanoic acid
Description:
Prostanoic acid, with the CAS number 25151-81-9, is a type of fatty acid that belongs to the family of prostaglandins, which are bioactive lipids involved in various physiological processes. This compound is characterized by its unsaturated structure, featuring a cyclopentane ring and multiple double bonds, which contribute to its biological activity. Prostanoic acid plays a crucial role in mediating inflammatory responses, regulating blood flow, and influencing smooth muscle contraction. It is typically found in small quantities in biological systems and is synthesized from arachidonic acid through the action of cyclooxygenase enzymes. The compound exhibits a range of effects on various tissues, including vasodilation and modulation of platelet aggregation. Due to its potent biological effects, prostanoic acid and its derivatives are of significant interest in pharmacology and medicine, particularly in the development of anti-inflammatory drugs and treatments for cardiovascular diseases. Its stability and reactivity can vary depending on environmental conditions, making it an important subject of study in both organic chemistry and biochemistry.
Formula:C20H38O2
InChI:InChI=1S/C20H38O2/c1-2-3-4-5-6-9-13-18-15-12-16-19(18)14-10-7-8-11-17-20(21)22/h18-19H,2-17H2,1H3,(H,21,22)/t18-,19-/m0/s1
InChI key:InChIKey=WGJJROVFWIXTPA-OALUTQOASA-N
SMILES:C(CCCCCC(O)=O)[C@@H]1[C@@H](CCCCCCCC)CCC1
Synonyms:- Prostanoic acid
- Prostan-1-oic acid
- (1S-trans)-2-Octylcyclopentaneheptanoic acid
- Cyclopentaneheptanoic acid, 2-octyl-, (1S-trans)-
- Cyclopentaneheptanoic acid, 2-octyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Prostanoic acid
CAS:Prostanoic acid is a potent inhibitor of tumor growth and has been shown to have anticancer properties. It is an analog of the thyroid hormone that inhibits the activity of kinases, proteins that regulate cell division and growth. Prostanoic acid has been found in urine samples from Chinese individuals with high levels of thyroid hormone, suggesting that it may play a role in cancer prevention. This compound has been shown to induce apoptosis, or programmed cell death, in cancer cells by blocking the activity of specific kinases. Prostanoic acid is being studied as a potential therapeutic agent for various types of cancer, and its kinase inhibitory properties make it a promising candidate for the development of new cancer treatments.Formula:C20H38O2Purity:Min. 95%Molecular weight:310.5 g/mol


