CAS 25156-39-2

4-[(diaminomethylidene)amino]benzenesulfonic acid

Description:

4-[(Diaminomethylidene)amino]benzenesulfonic acid, also known as sulfanilic acid, is an aromatic sulfonic acid characterized by its sulfonyl group (-SO3H) attached to a benzene ring, which also features an amino group (-NH2) and a diaminomethylidene moiety. This compound is typically a white to light yellow crystalline solid that is soluble in water, making it useful in various applications. It is primarily utilized as a reagent in the synthesis of azo dyes and as a pH indicator due to its ability to change color in response to pH variations. The presence of multiple amino groups enhances its reactivity, allowing it to participate in various chemical reactions, including coupling reactions in dye chemistry. Additionally, sulfanilic acid has been studied for its potential biological activities, including antimicrobial properties. However, safety precautions should be taken when handling this compound, as it may pose health risks upon exposure.

Formula: C₇H₉N₃O₃S

InChI: InChI=1/C7H9N3O3S/c8-7(9)10-5-1-3-6(4-2-5)14(11,12)13/h1-4H,(H4,8,9,10)(H,11,12,13)

SMILES: c1cc(ccc1NC(=N)N)S(=O)(=O)O

p-Guanidinobenzenesulfonic Acid

Controlled Product

CAS: 25156-39-2

Formula: C₇H₉N₃O₃S

Color and Shape: Neat

Molecular weight: 1934.81

Ref: TR-G821295