CAS 251577-10-3

N-[[5-[(1H-Imidazol-5-ylmethyl)amino]-2′-methyl[1,1′-biphenyl]-2-yl]carbonyl]-L-leucine

Description:

N-[[5-[(1H-Imidazol-5-ylmethyl)amino]-2′-methyl[1,1′-biphenyl]-2-yl]carbonyl]-L-leucine, with CAS number 251577-10-3, is a synthetic compound characterized by its complex structure, which includes an imidazole ring, a biphenyl moiety, and an amino acid component (L-leucine). This compound is typically classified as a peptide or peptide-like molecule due to the presence of the amino acid. Its structure suggests potential biological activity, possibly as a pharmaceutical agent or a biochemical probe, given the presence of functional groups that may interact with biological targets. The imidazole ring can participate in hydrogen bonding and coordination with metal ions, while the biphenyl structure may contribute to hydrophobic interactions. The compound's solubility, stability, and reactivity would depend on its specific functional groups and the overall molecular conformation. As with many synthetic compounds, its characteristics can be influenced by factors such as pH, temperature, and the presence of solvents or other reagents.

Formula: C₂₄H₂₈N₄O₃

InChI: InChI=1S/C24H28N4O3/c1-15(2)10-22(24(30)31)28-23(29)20-9-8-17(26-13-18-12-25-14-27-18)11-21(20)19-7-5-4-6-16(19)3/h4-9,11-12,14-15,22,26H,10,13H2,1-3H3,(H,25,27)(H,28,29)(H,30,31)/t22-/m0/s1

InChI key: InChIKey=GAJLKAVQYXFCRU-QFIPXVFZSA-N

SMILES: C(N[C@@H](CC(C)C)C(O)=O)(=O)C1=C(C=C(NCC2=CN=CN2)C=C1)C3=C(C)C=CC=C3

Synonyms:

• L-Leucine, N-[[5-[(1H-imidazol-5-ylmethyl)amino]-2′-methyl[1,1′-biphenyl]-2-yl]carbonyl]-
• GGTI 2154
• N-[[5-[(1H-Imidazol-5-ylmethyl)amino]-2′-methyl[1,1′-biphenyl]-2-yl]carbonyl]-L-leucine
• L-Leucine, N-[[5-[(1H-imidazol-4-ylmethyl)amino]-2′-methyl[1,1′-biphenyl]-2-yl]carbonyl]-

GGTI-2154

CAS: 251577-10-3

GGTI-2154 is an anticancer drug that has shown promising results in the treatment of various types of tumors. It is a potent inhibitor of geranylgeranyltransferase I (GGTase I), which is an enzyme that plays a crucial role in the signaling pathways involved in cancer cell growth and survival. GGTI-2154 has been shown to induce apoptosis (programmed cell death) in human cancer cells, leading to tumor regression. This drug is an analog of oseltamivir, a medication used to treat influenza, and it can be detected in urine samples after administration. GGTI-2154 targets specific kinases and proteins involved in cancer progression, making it a highly effective inhibitor with minimal side effects.

Formula: C₂₄H₂₈N₄O₃

Purity: Min. 95%

Molecular weight: 420.5 g/mol

Ref: 3D-BKA57710

GGTI-2154

CAS: 251577-10-3

GGTI-2154 is a potent, selective geranylgeranyltransferase I (GGTase I) inhibitor, boasting an IC50 of 21 nM and demonstrating over 200-fold selectivity against

Formula: C₂₄H₂₈N₄O₃

Color and Shape: Solid

Molecular weight: 420.5

Ref: TM-T37446