CAS 2516-37-2

2-bromo-6-nitro-1,3-benzothiazole

Description:

2-Bromo-6-nitro-1,3-benzothiazole is a heterocyclic organic compound characterized by the presence of both bromine and nitro functional groups attached to a benzothiazole ring system. The benzothiazole moiety consists of a fused benzene and thiazole ring, contributing to its aromatic properties and potential reactivity. The bromine atom, being a good leaving group, can facilitate various substitution reactions, while the nitro group is known for its electron-withdrawing effects, which can influence the compound's reactivity and stability. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique structure allows for potential applications in materials science and as a dye or pigment. Additionally, the presence of both bromine and nitro groups may impart specific biological activities, making it of interest in medicinal chemistry. Safety precautions should be observed when handling this compound, as both brominated and nitro compounds can pose health risks.

Formula: C₇H₃BrN₂O₂S

InChI: InChI=1/C7H3BrN2O2S/c8-7-9-5-2-1-4(10(11)12)3-6(5)13-7/h1-3H

SMILES: c1cc2c(cc1N(=O)=O)sc(Br)n2

Synonyms:

• 2-Bromo-6-nitrobenzothiazole
• Benzothiazole, 2-Bromo-6-Nitro-

Benzothiazole, 2-bromo-6-nitro-

CAS: 2516-37-2

Formula: C₇H₃BrN₂O₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 259.0799

Ref: IN-DA002QPA

2-Bromo-6-nitro-1,3-benzothiazole

CAS: 2516-37-2

2-Bromo-6-nitro-1,3-benzothiazole

Formula: C₇H₃BrN₂O₂S

Purity: 95%

Color and Shape: Powder

Molecular weight: 259.08g/mol

Ref: 54-OR14034

2-Bromo-6-nitrobenzothiazole

CAS: 2516-37-2

Formula: C₇H₃BrN₂O₂S

Purity: 98%

Molecular weight: 259.08

Ref: 10-F216848

2-Bromo-6-nitro-1,3-benzothiazole

CAS: 2516-37-2

2-Bromo-6-nitro-1,3-benzothiazole is a synthetic compound that is used in optical chemistry. It functions as a coupling agent and has been shown to be efficient in its use. 2-Bromo-6-nitro-1,3-benzothiazole also has magnetic properties, which can be useful for synthesizing polymers. This compound is an organic compound that belongs to the family of heterocycles and has redox properties, electrochemical properties, and structural properties. The synthesis of 2-bromo-6 nitrobenzothiazole involves the following steps:

Formula: C₇H₃BrN₂O₂S

Purity: Min. 95%

Molecular weight: 259.08 g/mol

Ref: 3D-CAA51637